Fortfahren mit
Größe auswählen
| Ihnen/SKU | Verfügbarkeit | Preis |
|---|
Über diesen Artikel
biological source
synthetic
Quality Segment
color
white to off-white
antibiotic activity spectrum
Gram-negative bacteria, Gram-positive bacteria
mode of action
DNA synthesis | interferes, enzyme | inhibits
storage temp.
−20°C
SMILES string
Cl.CCN1C=C(C(O)=O)C(=O)c2cc(F)c(N3CCNC(C)C3)c(F)c12
InChI
1S/C17H19F2N3O3.ClH/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22;/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25);1H
InChI key
KXEBLAPZMOQCKO-UHFFFAOYSA-N
General description
Application
Biochem/physiol Actions
1 of 1
Dieser Artikel | |||
|---|---|---|---|
| description - | description ≥98% (HPLC) | description VETRANAL®, analytical standard | description analytical standard |
| antibiotic activity spectrum Gram-negative bacteria, Gram-positive bacteria | antibiotic activity spectrum Gram-negative bacteria, Gram-positive bacteria | antibiotic activity spectrum Gram-negative bacteria, Gram-positive bacteria | antibiotic activity spectrum - |
| mode of action enzyme | inhibits, DNA synthesis | interferes | mode of action DNA synthesis | interferes, enzyme | inhibits | mode of action DNA synthesis | interferes, enzyme | inhibits | mode of action - |
| Quality Level 200 | Quality Level 200 | Quality Level 100 | Quality Level 100 |
| storage temp. −20°C | storage temp. - | storage temp. - | storage temp. 2-8°C |
| biological source synthetic | biological source - | biological source - | biological source - |
| color white to off-white | color - | color - | color - |
Hier finden Sie alle aktuellen Versionen:
Besitzen Sie dieses Produkt bereits?
In der Dokumentenbibliothek finden Sie die Dokumentation zu den Produkten, die Sie kürzlich erworben haben.



