Przejdź do
707589
RuPhos Pd G1 Methyl t-Butyl Ether Adduct
95%, solid
Synonim(y):
(RuPhos) palladium(II) phenethylamine chloride (1:1 MTBE solvate), Chloro-(2-Dicyclohexylphosphino-2′,6′-diisopropoxy-1,1′-biphenyl)[2-(2-aminoethyl)phenyl]palladium(II) - methyl-t-butyl ether adduct, RuPhos Palladacycle, RuPhos precatalyst
Wybierz wielkość
| Rozmiar/SKU | Dostępność | Cena netto |
|---|---|---|
250 mg | Skontaktuj się z Obsługą Klienta, aby uzyskać informacje na temat dostępności | 506,00 zł 379,50 zł |
1 g | Skontaktuj się z Obsługą Klienta, aby uzyskać informacje na temat dostępności | 1960,00 zł 1470,00 zł |
Informacje o tej pozycji
379,50 zł
Cena katalogowa506,00 złZaoszczędź 25%Nazwa produktu
RuPhos Pd G1 Methyl t-Butyl Ether Adduct, 95%
Quality Segment
product line
Buchwald precatalyst Generation 1
assay
95%
form
solid
feature
generation 1
reaction suitability
core: palladium, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Heck Reaction, reaction type: Hiyama Coupling, reaction type: Negishi Coupling, reaction type: Sonogashira Coupling, reaction type: Stille Coupling, reaction type: Suzuki-Miyaura Coupling, reagent type: catalyst
reaction type: Cross Couplings
mp
180-200 °C
functional group
phosphine
SMILES string
COC(C)(C)C.NCCc1ccccc1[Pd]Cl.CC(C)Oc2cccc(OC(C)C)c2-c3ccccc3P(C4CCCCC4)C5CCCCC5
InChI
1S/C30H43O2P.C8H10N.C5H12O.ClH.Pd/c1-22(2)31-27-19-13-20-28(32-23(3)4)30(27)26-18-11-12-21-29(26)33(24-14-7-5-8-15-24)25-16-9-6-10-17-25;9-7-6-8-4-2-1-3-5-8;1-5(2,3)6-4;;/h11-13,18-25H,5-10,14-17H2,1-4H3;1-4H,6-7,9H2;1-4H3;1H;/q;;;;+1/p-1
InChI key
OMMPYFRVDWZBNR-UHFFFAOYSA-M
Application
Legal Information
1 of 1
Ta pozycja | |||
|---|---|---|---|
| description 95% | description - | description 98% | description may contain up to 1 mole equivalent of MTBE, 97% |
| assay 95% | assay - | assay 98% | assay 97% |
| reaction suitability reagent type: catalyst | reaction suitability reagent type: catalyst | reaction suitability reaction type: Suzuki-Miyaura Coupling, core: palladium, reaction type: Sonogashira Coupling, reaction type: Heck Reaction, reaction type: Stille Coupling, reaction type: Negishi Coupling, reagent type: catalyst | reaction suitability reaction type: Stille Coupling, core: palladium, reaction type: Sonogashira Coupling, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Negishi Coupling, reagent type: catalyst |
| form solid | form solid | form solid | form solid |
| functional group phosphine | functional group phosphine | functional group phosphine | functional group phosphine |
| Quality Level 100 | Quality Level 100 | Quality Level 100 | Quality Level 100 |
| mp 180-200 °C | mp 160-170 °C | mp 188-196 °C (decomposition) | mp 198-204 °C |
Słowo ostrzegawcze
Danger
Kody zagrożeń
Hazard Classifications
Eye Dam. 1 - Skin Corr. 1B - STOT SE 3
Narządy docelowe
Respiratory system
Klasa składowania
8A - Combustible corrosive hazardous materials
PPE (środki ochrony indywidualnej)
dust mask type N95 (US), Eyeshields, Gloves
Wykazy regulacyjne
Wykazy regulacyjne dotyczą głównie produktów chemicznych. Można w nich podawać ograniczoną liczbę informacji na temat produktów niechemicznych. Brak wpisu oznacza, że żaden ze składników nie znajduje się w wykazie. Użytkownik odpowiada za zagwarantowanie bezpiecznego i zgodnego z prawem stosowania produktu.
1634-04-4
Wybierz jedną z najnowszych wersji:
Masz już ten produkt?
Dokumenty związane z niedawno zakupionymi produktami zostały zamieszczone w Bibliotece dokumentów.