Przejdź do
42237
Fmoc-His(Trt)-Wang resin
extent of labeling: ~0.7 mmol/g loading
Synonim(y):
Nα-Fmoc-N(im)-trityl-L-histidine 4-benzyloxybenzyl ester polymer-bound, PS-PHB-His(Trt)-Fmoc
Wybierz wielkość
| Rozmiar/SKU | Dostępność | Cena netto |
|---|---|---|
1 g | Skontaktuj się z Obsługą Klienta, aby uzyskać informacje na temat dostępności | 696,00 zł |
Informacje o tej pozycji
696,00 zł
reaction suitability
reaction type: Fmoc solid-phase peptide synthesis
Quality Segment
extent of labeling
~0.7 mmol/g loading
particle size
80-160 μm
application(s)
peptide synthesis
functional group
Fmoc
storage temp.
2-8°C
SMILES string
[X]C(=O)[C@@H](NC(=O)OCC5c6c(cccc6)c7c5cccc7)Cc1nc[n](c1)C(c4ccccc4)(c3ccccc3)c2ccccc2
1 of 1
Ta pozycja | |||
|---|---|---|---|
| description extent of labeling: ~0.7 mmol/g loading | description extent of labeling: ~0.7 mmol/g loading | description extent of labeling: 0.4-0.8 mmol/g loading | description extent of labeling: 0.4-0.8 mmol/g loading |
| Quality Level 100 | Quality Level 100 | Quality Level 100 | Quality Level 100 |
| application(s) peptide synthesis | application(s) peptide synthesis | application(s) peptide synthesis | application(s) peptide synthesis |
| storage temp. 2-8°C | storage temp. 2-8°C | storage temp. 2-8°C | storage temp. 2-8°C |
| reaction suitability reaction type: Fmoc solid-phase peptide synthesis | reaction suitability reaction type: Fmoc solid-phase peptide synthesis | reaction suitability reaction type: Fmoc solid-phase peptide synthesis | reaction suitability reaction type: Fmoc solid-phase peptide synthesis |
| functional group Fmoc | functional group Fmoc | functional group Fmoc | functional group Fmoc |
| particle size 80-160 μm | particle size 37-75 μm | particle size 100-200 mesh | particle size 100-200 mesh |
Klasa składowania
11 - Combustible Solids
Co się dzieje?
WGK 3
Temperatura zapłonu (°F)
Not applicable
Temperatura zapłonu (°C)
Not applicable
PPE (środki ochrony indywidualnej)
Eyeshields, Gloves, type N95 (US)
Wybierz jedną z najnowszych wersji:
Masz już ten produkt?
Dokumenty związane z niedawno zakupionymi produktami zostały zamieszczone w Bibliotece dokumentów.