Fortfahren mit
398799
Dichlor(1,10-phenanthrolin)palladium(II)
Größe auswählen
| Größe/SKU | Verfügbarkeit | Preis |
|---|---|---|
1 g | Warenkorb auf Verfügbarkeit prüfen | € 365,00 € 273,75 |
Über diesen Artikel
€ 273,75
Listenpreis€ 365,00Sparen Sie 25%Quality Segment
reaction suitability
core: palladium, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Cross Couplings, reaction type: Heck Reaction, reaction type: Hiyama Coupling, reaction type: Negishi Coupling, reaction type: Sonogashira Coupling, reaction type: Stille Coupling, reaction type: Suzuki-Miyaura Coupling, reagent type: catalyst
SMILES string
Cl[Pd]Cl.c1cnc2c(c1)ccc3cccnc23
InChI
1S/C12H8N2.2ClH.Pd/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;;;/h1-8H;2*1H;/q;;;+2/p-2
InChI key
YGAISFRMWCCXCG-UHFFFAOYSA-L
Application
- Carbonylation of alkyl nitrites
- Arylation reactions
- Multiple acetylene insertions under Sonogashira reaction protocol
- Cross-coupling reactions of pyridine carboxylic acid chlorides with alkylzinc reagents
- Hydrophosphinylation of alkenes and alkynes
- Heck reaction
- Regioselective and stereoselective aminohalogenation reactions
- Reaction of chloroenynes and chlorodienes with Grignard reagents for the synthesis of stereodefined enynes and dienes
- Affects the aggregation of human prion protein PrP106-126
1 of 1
Dieser Artikel | |||
|---|---|---|---|
| description - | description 95% | description 97% | description 95% |
| reaction suitability reagent type: catalyst, core: palladium, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Hiyama Coupling, reaction type: Sonogashira Coupling, reaction type: Cross Couplings, reaction type: Heck Reaction, reaction type: Negishi Coupling, reaction type: Stille Coupling, reaction type: Suzuki-Miyaura Coupling | reaction suitability reaction type: Heck Reaction, reaction type: Sonogashira Coupling, core: palladium, reagent type: catalyst, reaction type: Cross Couplings, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Stille Coupling, reaction type: Hiyama Coupling, reaction type: Negishi Coupling, reaction type: Suzuki-Miyaura Coupling | reaction suitability reagent type: catalyst, reaction type: Heck Reaction, reaction type: Sonogashira Coupling, reaction type: Hiyama Coupling, reaction type: Negishi Coupling, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Cross Couplings, reaction type: Stille Coupling, reaction type: Suzuki-Miyaura Coupling, core: palladium | reaction suitability reagent type: catalyst, reaction type: Negishi Coupling, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Sonogashira Coupling, reaction type: Suzuki-Miyaura Coupling, reaction type: Cross Couplings, core: palladium, reaction type: Heck Reaction, reaction type: Stille Coupling, reaction type: Hiyama Coupling |
| Quality Level 200 | Quality Level 100 | Quality Level 100 | Quality Level 100 |
![Dichloro[9,9-dimethyl-4,5-bis(diphenylphosphino)xanthene]palladium(II) 95%](/deepweb/assets/sigmaaldrich/product/structures/374/597/f7932c5b-0448-498b-8254-f8ce1b9a4612/640/f7932c5b-0448-498b-8254-f8ce1b9a4612.png)
![Dichloro[2,2′-bis(diphenylphosphino)-1,1′-binaphthyl]palladium(II) 97%](/deepweb/assets/sigmaaldrich/product/structures/351/904/a38f7a0d-b8a0-448f-b949-4b983e7f1eb3/640/a38f7a0d-b8a0-448f-b949-4b983e7f1eb3.png)
Lagerklasse
11 - Combustible Solids
wgk
WGK 3
flash_point_f
Not applicable
flash_point_c
Not applicable
Hier finden Sie alle aktuellen Versionen:
Besitzen Sie dieses Produkt bereits?
In der Dokumentenbibliothek finden Sie die Dokumentation zu den Produkten, die Sie kürzlich erworben haben.