Przejdź do
Wybierz wielkość
| Rozmiar/SKU | Dostępność | Cena netto |
|---|---|---|
250 mg | Skontaktuj się z Obsługą Klienta, aby uzyskać informacje na temat dostępności | 453,00 zł 339,75 zł |
1 g | Skontaktuj się z Obsługą Klienta, aby uzyskać informacje na temat dostępności | 2030,00 zł 1522,50 zł |
Informacje o tej pozycji
339,75 zł
Cena katalogowa453,00 złZaoszczędź 25%Nazwa produktu
TrixiePhos Pd G3,
Quality Segment
product line
Buchwald precatalyst Generation 3
form
solid
feature
generation 3
reaction suitability
reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Heck Reaction, reaction type: Hiyama Coupling, reaction type: Negishi Coupling, reaction type: Sonogashira Coupling, reaction type: Stille Coupling, reaction type: Suzuki-Miyaura Coupling, reagent type: catalyst
reaction type: Cross Couplings
mp
150-155 °C (decompose with no melt)
functional group
phosphine
SMILES string
NC1=C(C=CC=C1)C2=C([Pd]OS(C)(=O)=O)C=CC=C2.CC(C)(C)P(C3=CC=C4C(C=CC=C4)=C3C5=CC=CC6=C5C=CC=C6)C(C)(C)C
InChI
1S/C28H31P.C12H10N.CH4O3S.Pd/c1-27(2,3)29(28(4,5)6)25-19-18-21-13-8-10-16-23(21)26(25)24-17-11-14-20-12-7-9-15-22(20)24;13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;1-5(2,3)4;/h7-19H,1-6H3;1-6,8-9H,13H2;1H3,(H,2,3,4);/q;;;+1/p-1
InChI key
VEUUEPDQCSBCQL-UHFFFAOYSA-M
1 of 1
Ta pozycja | |||
|---|---|---|---|
| description - | description 97% | description 95% | description - |
| reaction suitability reaction type: Suzuki-Miyaura Coupling, reaction type: Sonogashira Coupling, reaction type: Stille Coupling, reaction type: Negishi Coupling, reaction type: Hiyama Coupling, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reagent type: catalyst | reaction suitability reaction type: Sonogashira Coupling, reagent type: ligand | reaction suitability reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Suzuki-Miyaura Coupling, reaction type: Stille Coupling, reaction type: Hiyama Coupling, reaction type: Negishi Coupling, reaction type: Heck Reaction, reaction type: Sonogashira Coupling, core: palladium, reagent type: catalyst | reaction suitability reaction type: Sonogashira Coupling, reaction type: Buchwald-Hartwig Cross Coupling Reaction, reaction type: Negishi Coupling, reaction type: Suzuki-Miyaura Coupling, reagent type: catalyst |
| functional group phosphine | functional group phosphine | functional group phosphine | functional group phosphine |
| form solid | form powder | form powder or crystals | form solid |
| Quality Level 100 | Quality Level 100 | Quality Level 100 | Quality Level 100 |
| mp 150-155 °C (decompose with no melt) | mp 144-148 °C | mp - | mp 150-159 °C |
| product line Buchwald precatalyst Generation 3 | product line Buchwald Ligand | product line Buchwald precatalyst Generation 3 | product line Buchwald precatalyst Generation 1 |
Klasa składowania
11 - Combustible Solids
wgk
WGK 3
flash_point_f
Not applicable
flash_point_c
Not applicable
Wybierz jedną z najnowszych wersji:
Masz już ten produkt?
Dokumenty związane z niedawno zakupionymi produktami zostały zamieszczone w Bibliotece dokumentów.



