Przejdź do
Wybierz wielkość
| Rozmiar/SKU | Dostępność | Cena netto |
|---|---|---|
250 mg | Skontaktuj się z Obsługą Klienta, aby uzyskać informacje na temat dostępności | 3780,00 zł |
Informacje o tej pozycji
3780,00 zł
Quality Segment
isotopic purity
98 atom % 13C, 98 atom % 15N
assay
95% (CP)
form
solid
optical activity
[α]25/D -12.0°, c = 1 in 1 M HCl
technique(s)
bio NMR: suitable, protein expression: suitable
mp
>300 °C (dec.) (lit.)
mass shift
M+10
SMILES string
[15NH2][13C@@H]([13CH2][13c]1[13cH][13cH][13c](O)[13cH][13cH]1)[13C](O)=O
InChI
1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/t8-/m0/s1/i1+1,2+1,3+1,4+1,5+1,6+1,7+1,8+1,9+1,10+1
InChI key
OUYCCCASQSFEME-CMLFETTRSA-N
Packaging
Stable Isotopes Customer Service.
1 of 1
Ta pozycja | |||
|---|---|---|---|
| description 98 atom % 13C, 98 atom % 15N, 95% (CP) | description 98 atom % 13C, 95% (CP) | description 99 atom % 13C, 99% (CP) | description 98 atom % 13C, 98 atom % 15N |
| isotopic purity 98 atom % 15N, 98 atom % 13C | isotopic purity 98 atom % 13C | isotopic purity 99 atom % 13C | isotopic purity 98 atom % 13C, 98 atom % 15N |
| mass shift M+10 | mass shift M+9 | mass shift M+6 | mass shift M+5 |
| assay 95% (CP) | assay 95% (CP) | assay 99% (CP) | assay 95% (CP) |
| technique(s) protein expression: suitable, bio NMR: suitable | technique(s) protein expression: suitable | technique(s) protein expression: suitable | technique(s) bio NMR: suitable, protein expression: suitable |
| Quality Level 200 | Quality Level 200 | Quality Level 200 | Quality Level 200 |
| form solid | form solid | form solid | form solid |
Still not finding the right product?
Explore all of our products under L-Tyrosine-13C9,15N
Klasa składowania
11 - Combustible Solids
Co się dzieje?
WGK 1
Temperatura zapłonu (°F)
Not applicable
Temperatura zapłonu (°C)
Not applicable
PPE (środki ochrony indywidualnej)
dust mask type N95 (US), Eyeshields, Gloves
Wybierz jedną z najnowszych wersji:
Masz już ten produkt?
Dokumenty związane z niedawno zakupionymi produktami zostały zamieszczone w Bibliotece dokumentów.



