Przejdź do
Wybierz wielkość
| Rozmiar/SKU | Dostępność | Cena netto |
|---|---|---|
5 g | Skontaktuj się z Obsługą Klienta, aby uzyskać informacje na temat dostępności | 2600,00 zł |
Informacje o tej pozycji
2600,00 zł
isotopic purity
60 atom % 15N
Quality Segment
mol wt
133.34 by atom % calculation (60 atom % 15N)
mp
>280 °C (dec.) (lit.)
application(s)
agriculture
mass shift
M+2
SMILES string
[15NH3].[15NH3].OS(O)(=O)=O
InChI
1S/2H3N.H2O4S/c;;1-5(2,3)4/h2*1H3;(H2,1,2,3,4)/i2*1+1;
InChI key
BFNBIHQBYMNNAN-ISOLYIDJSA-N
Packaging
Stable Isotopes Customer Service.
1 of 1
Ta pozycja | |||
|---|---|---|---|
| description 60 atom % 15N | description 98 atom % 15N | description 10 atom % 15N | description 20 atom % 15N |
| isotopic purity 60 atom % 15N | isotopic purity 98 atom % 15N | isotopic purity 10 atom % 15N | isotopic purity 20 atom % 15N |
| mass shift M+2 | mass shift M+2 | mass shift M+2 | mass shift M+2 |
| Quality Level 200 | Quality Level 200 | Quality Level 200 | Quality Level - |
| mp >280 °C (dec.) (lit.) | mp >280 °C (dec.) (lit.) | mp >280 °C (dec.) (lit.) | mp >280 °C (dec.) (lit.) |
| application(s) agriculture | application(s) - | application(s) agriculture | application(s) - |
| mol wt 133.34 by atom % calculation (60 atom % 15N) | mol wt - | mol wt 132.34 by atom % calculation (10 atom % 15N) | mol wt 132.54 by atom % calculation (20 atom % 15N) |
Still not finding the right product?
Explore all of our products under Ammonium-15N2 sulfate
Klasa składowania
11 - Combustible Solids
Co się dzieje?
WGK 1
Temperatura zapłonu (°F)
Not applicable
Temperatura zapłonu (°C)
Not applicable
PPE (środki ochrony indywidualnej)
Eyeshields, Gloves, type N95 (US)
Wybierz jedną z najnowszych wersji:
Masz już ten produkt?
Dokumenty związane z niedawno zakupionymi produktami zostały zamieszczone w Bibliotece dokumentów.
