추천 제품
분석
≥97.0%
불순물
≤3.0% water
≤50 mg/kg halogens (as chloride)
음이온 미량물
bromide (Br-): 50 mg/kg
chloride (Cl-): 50 mg/kg
fluoride (F-): 50 mg/kg
nitrate (NO3-): 50 mg/kg
sulfate (SO42-): 2000 mg/kg
SMILES string
[O-]S(=O)(=O)C(F)(F)F.CCCCn1cc[n+](CCCCS(O)(=O)=O)c1
시험 성적서(COA)
제품의 로트/배치 번호를 입력하여 시험 성적서(COA)을 검색하십시오. 로트 및 배치 번호는 제품 라벨에 있는 ‘로트’ 또는 ‘배치’라는 용어 뒤에서 찾을 수 있습니다.
이미 열람한 고객
Nature communications, 9(1), 2740-2740 (2018-07-18)
Conductive and stretchable materials that match the elastic moduli of biological tissue (0.5-500 kPa) are desired for enhanced interfacial and mechanical stability. Compared with inorganic and dry polymeric conductors, hydrogels made with conducting polymers are promising soft electrode materials due to
자사의 과학자팀은 생명 과학, 재료 과학, 화학 합성, 크로마토그래피, 분석 및 기타 많은 영역을 포함한 모든 과학 분야에 경험이 있습니다..
고객지원팀으로 연락바랍니다.